C14H15ClN6O7 — CID 158934174
2-[[(2S,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-4-hydroxy-3-(methylideneamino)oxolan-2-yl]methoxy]propanedioic acid (PubChem CID 158934174) has the molecular formula C14H15ClN6O7 and a molecular weight of 414.76 g/mol. Its IUPAC name is 2-[[(2S,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-4-hydroxy-3-(methylideneamino)oxolan-2-yl]methoxy]propanedioic acid.
| Compound Name | 2-[[(2S,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-4-hydroxy-3-(methylideneamino)oxolan-2-yl]methoxy]propanedioic acid |
|---|---|
| PubChem CID | 158934174 |
| Molecular Formula | C14H15ClN6O7 |
| Molecular Weight | 414.76 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 2-[[(2S,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-4-hydroxy-3-(methylideneamino)oxolan-2-yl]methoxy]propanedioic acid |
| SMILES | C=N[C@H]1[C@@H](O)[C@H](n2cnc3c(N)nc(Cl)nc32)O[C@@H]1COC(C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H15ClN6O7/c1-17-5-4(2-27-8(12(23)24)13(25)26)28-11(7(5)22)21-3-18-6-9(16)19-14(15)20-10(6)21/h3-5,7-8,11,22H,1-2H2,(H,23,24)(H,25,26)(H2,16,19,20)/t4-,5-,7-,11-/m1/s1 |
| InChIKey | JJLCTQFXBZJGON-LHZBONMMSA-N |
| XLogP | -1.06 |
| TPSA | 195.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.76 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|