C16H23ClN5O9P — CID 146559694
[1-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phosphonic acid (PubChem CID 146559694) has the molecular formula C16H23ClN5O9P and a molecular weight of 495.81 g/mol. Its IUPAC name is [1-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phosphonic acid.
| Compound Name | [1-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 146559694 |
| Molecular Formula | C16H23ClN5O9P |
| Molecular Weight | 495.81 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | [1-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]phosphonic acid |
| SMILES | CC(C)(C)OC(=O)C(OC[C@H]1O[C@@H](n2cnc3c(N)nc(Cl)nc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C16H23ClN5O9P/c1-16(2,3)31-13(25)14(32(26,27)28)29-4-6-8(23)9(24)12(30-6)22-5-19-7-10(18)20-15(17)21-11(7)22/h5-6,8-9,12,14,23-24H,4H2,1-3H3,(H2,18,20,21)(H2,26,27,28)/t6-,8-,9-,12-,14?/m1/s1 |
| InChIKey | BUTFLJWWPJBBOC-OAPDWXTOSA-N |
| XLogP | -0.46 |
| TPSA | 212.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.81 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|