C16H24ClN6O8P — CID 118469676
[(1R)-1-[[(2R,3R,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(tert-butylamino)-2-oxoethyl]phosphonic acid (PubChem CID 118469676) has the molecular formula C16H24ClN6O8P and a molecular weight of 494.83 g/mol. Its IUPAC name is [(1R)-1-[[(2R,3R,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(tert-butylamino)-2-oxoethyl]phosphonic acid.
| Compound Name | [(1R)-1-[[(2R,3R,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(tert-butylamino)-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 118469676 |
| Molecular Formula | C16H24ClN6O8P |
| Molecular Weight | 494.83 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | [(1R)-1-[[(2R,3R,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(tert-butylamino)-2-oxoethyl]phosphonic acid |
| SMILES | CC(C)(C)NC(=O)[C@H](OC[C@H]1O[C@@H](n2cnc3c(N)nc(Cl)nc32)[C@H](O)[C@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C16H24ClN6O8P/c1-16(2,3)22-12(26)14(32(27,28)29)30-4-6-8(24)9(25)13(31-6)23-5-19-7-10(18)20-15(17)21-11(7)23/h5-6,8-9,13-14,24-25H,4H2,1-3H3,(H,22,26)(H2,18,20,21)(H2,27,28,29)/t6-,8+,9-,13-,14-/m1/s1 |
| InChIKey | JXCYHMOVNGKBFH-YUIACZCCSA-N |
| XLogP | -0.88 |
| TPSA | 215.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.83 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|