C12H15ClN5O8P — CID 146474585
[2-[[5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxoethyl]phosphonic acid (PubChem CID 146474585) has the molecular formula C12H15ClN5O8P and a molecular weight of 423.71 g/mol. Its IUPAC name is [2-[[5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxoethyl]phosphonic acid.
| Compound Name | [2-[[5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 146474585 |
| Molecular Formula | C12H15ClN5O8P |
| Molecular Weight | 423.71 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | [2-[[5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-oxoethyl]phosphonic acid |
| SMILES | Nc1nc(Cl)nc2c1ncn2C1OC(COC(=O)CP(=O)(O)O)C(O)C1O |
| InChI | InChI=1S/C12H15ClN5O8P/c13-12-16-9(14)6-10(17-12)18(3-15-6)11-8(21)7(20)4(26-11)1-25-5(19)2-27(22,23)24/h3-4,7-8,11,20-21H,1-2H2,(H2,14,16,17)(H2,22,23,24) |
| InChIKey | MQANPSBBDRHOFO-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 203.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.71 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|