C10H15ClN5NaO13P3 — CID 172652995
CID 172652995 (PubChem CID 172652995) has the molecular formula C10H15ClN5NaO13P3 and a molecular weight of 564.62 g/mol.
| Compound Name | CID 172652995 |
|---|---|
| PubChem CID | 172652995 |
| Molecular Formula | C10H15ClN5NaO13P3 |
| Molecular Weight | 564.62 g/mol |
| Exact Mass | 563.95 |
| IUPAC Name | — |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O.[Na] |
| InChI | InChI=1S/C10H15ClN5O13P3.Na/c11-10-14-7(12)4-8(15-10)16(2-13-4)9-6(18)5(17)3(27-9)1-26-31(22,23)29-32(24,25)28-30(19,20)21;/h2-3,5-6,9,17-18H,1H2,(H,22,23)(H,24,25)(H2,12,14,15)(H2,19,20,21);/t3-,5-,6-,9-;/m1./s1 |
| InChIKey | CDTRCNDYMJWKJX-GWTDSMLYSA-N |
| XLogP | -1.36 |
| TPSA | 279.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.62 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|