C11H17ClN5O13P3 — CID 46222214
[[(2R,3S,4R,5R)-5-[2-chloro-6-(methylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 46222214) has the molecular formula C11H17ClN5O13P3 and a molecular weight of 555.65 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[2-chloro-6-(methylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-[2-chloro-6-(methylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 46222214 |
| Molecular Formula | C11H17ClN5O13P3 |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 554.97 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[2-chloro-6-(methylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CNc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H17ClN5O13P3/c1-13-8-5-9(16-11(12)15-8)17(3-14-5)10-7(19)6(18)4(28-10)2-27-32(23,24)30-33(25,26)29-31(20,21)22/h3-4,6-7,10,18-19H,2H2,1H3,(H,23,24)(H,25,26)(H,13,15,16)(H2,20,21,22)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | ZVCOEXCABQFGCG-KQYNXXCUSA-N |
| XLogP | -0.52 |
| TPSA | 265.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|