C16H24ClN5O9P2 — CID 166784017
[[(2R,3S,4R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-methylphosphinic acid (PubChem CID 166784017) has the molecular formula C16H24ClN5O9P2 and a molecular weight of 527.80 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-methylphosphinic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-methylphosphinic acid |
|---|---|
| PubChem CID | 166784017 |
| Molecular Formula | C16H24ClN5O9P2 |
| Molecular Weight | 527.80 g/mol |
| Exact Mass | 527.07 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-methylphosphinic acid |
| SMILES | CP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H24ClN5O9P2/c1-32(25,26)31-33(27,28)29-6-9-11(23)12(24)15(30-9)22-7-18-10-13(19-8-4-2-3-5-8)20-16(17)21-14(10)22/h7-9,11-12,15,23-24H,2-6H2,1H3,(H,25,26)(H,27,28)(H,19,20,21)/t9-,11-,12-,15-/m1/s1 |
| InChIKey | QTFHFDQTYLLDKT-SDBHATRESA-N |
| XLogP | 1.40 |
| TPSA | 198.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.80 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|