C16H22ClN5O3 — CID 123459767
(2R,3R,4S,5R)-2-[2-chloro-6-(cyclohexylamino)purin-9-yl]-5-methyloxolane-3,4-diol (PubChem CID 123459767) has the molecular formula C16H22ClN5O3 and a molecular weight of 367.84 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[2-chloro-6-(cyclohexylamino)purin-9-yl]-5-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[2-chloro-6-(cyclohexylamino)purin-9-yl]-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 123459767 |
| Molecular Formula | C16H22ClN5O3 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (2R,3R,4S,5R)-2-[2-chloro-6-(cyclohexylamino)purin-9-yl]-5-methyloxolane-3,4-diol |
| SMILES | C[C@H]1O[C@@H](n2cnc3c(NC4CCCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H22ClN5O3/c1-8-11(23)12(24)15(25-8)22-7-18-10-13(20-16(17)21-14(10)22)19-9-5-3-2-4-6-9/h7-9,11-12,15,23-24H,2-6H2,1H3,(H,19,20,21)/t8-,11-,12-,15-/m1/s1 |
| InChIKey | VVNVPSLLBUCVCZ-PMXXHBEXSA-N |
| XLogP | 1.86 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |