C24H38N6O4 — CID 44585185
(2R,3R,4S,5R)-2-[2,6-bis(cycloheptylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 44585185) has the molecular formula C24H38N6O4 and a molecular weight of 474.61 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[2,6-bis(cycloheptylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[2,6-bis(cycloheptylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 44585185 |
| Molecular Formula | C24H38N6O4 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | (2R,3R,4S,5R)-2-[2,6-bis(cycloheptylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(NC4CCCCCC4)nc(NC4CCCCCC4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H38N6O4/c31-13-17-19(32)20(33)23(34-17)30-14-25-18-21(26-15-9-5-1-2-6-10-15)28-24(29-22(18)30)27-16-11-7-3-4-8-12-16/h14-17,19-20,23,31-33H,1-13H2,(H2,26,27,28,29)/t17-,19-,20-,23-/m1/s1 |
| InChIKey | QPFSHGLBLXUSQV-ZDXOVATRSA-N |
| XLogP | 2.71 |
| TPSA | 137.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |