C16H22N6O4 — CID 44585168
(2R,3R,4S,5R)-2-[2,6-bis(cyclopropylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 44585168) has the molecular formula C16H22N6O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[2,6-bis(cyclopropylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[2,6-bis(cyclopropylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 44585168 |
| Molecular Formula | C16H22N6O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (2R,3R,4S,5R)-2-[2,6-bis(cyclopropylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(NC4CC4)nc(NC4CC4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H22N6O4/c23-5-9-11(24)12(25)15(26-9)22-6-17-10-13(18-7-1-2-7)20-16(21-14(10)22)19-8-3-4-8/h6-9,11-12,15,23-25H,1-5H2,(H2,18,19,20,21)/t9-,11-,12-,15-/m1/s1 |
| InChIKey | GHSVXXWPMLCESG-SDBHATRESA-N |
| XLogP | -0.41 |
| TPSA | 137.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |