C15H19Cl2N5O4 — CID 22868429
(2R,3R,4S,5S)-2-[2-chloro-6-(cyclopentyloxyamino)purin-9-yl]-5-(chloromethyl)oxolane-3,4-diol (PubChem CID 22868429) has the molecular formula C15H19Cl2N5O4 and a molecular weight of 404.25 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[2-chloro-6-(cyclopentyloxyamino)purin-9-yl]-5-(chloromethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-[2-chloro-6-(cyclopentyloxyamino)purin-9-yl]-5-(chloromethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 22868429 |
| Molecular Formula | C15H19Cl2N5O4 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | (2R,3R,4S,5S)-2-[2-chloro-6-(cyclopentyloxyamino)purin-9-yl]-5-(chloromethyl)oxolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H](CCl)O[C@H]1n1cnc2c(NOC3CCCC3)nc(Cl)nc21 |
| InChI | InChI=1S/C15H19Cl2N5O4/c16-5-8-10(23)11(24)14(25-8)22-6-18-9-12(19-15(17)20-13(9)22)21-26-7-3-1-2-4-7/h6-8,10-11,14,23-24H,1-5H2,(H,19,20,21)/t8-,10-,11-,14-/m1/s1 |
| InChIKey | CNTAVKSOKGBUOU-IDTAVKCVSA-N |
| XLogP | 1.62 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|