C16H21Cl2N5O3 — CID 42625615
(2R,3R,4R,5S)-2-[2-chloro-6-(cyclopentylamino)purin-9-yl]-5-(chloromethyl)-3-methyloxolane-3,4-diol (PubChem CID 42625615) has the molecular formula C16H21Cl2N5O3 and a molecular weight of 402.28 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-[2-chloro-6-(cyclopentylamino)purin-9-yl]-5-(chloromethyl)-3-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-2-[2-chloro-6-(cyclopentylamino)purin-9-yl]-5-(chloromethyl)-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 42625615 |
| Molecular Formula | C16H21Cl2N5O3 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | (2R,3R,4R,5S)-2-[2-chloro-6-(cyclopentylamino)purin-9-yl]-5-(chloromethyl)-3-methyloxolane-3,4-diol |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](CCl)O[C@H]1n1cnc2c(NC3CCCC3)nc(Cl)nc21 |
| InChI | InChI=1S/C16H21Cl2N5O3/c1-16(25)11(24)9(6-17)26-14(16)23-7-19-10-12(20-8-4-2-3-5-8)21-15(18)22-13(10)23/h7-9,11,14,24-25H,2-6H2,1H3,(H,20,21,22)/t9-,11-,14-,16-/m1/s1 |
| InChIKey | GHKVAAPTNWFDFP-ROMFRFKVSA-N |
| XLogP | 2.08 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|