C12H15ClFN5O3 — CID 172874081
5-[2-chloro-6-(methylamino)purin-9-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol (PubChem CID 172874081) has the molecular formula C12H15ClFN5O3 and a molecular weight of 331.74 g/mol. Its IUPAC name is 5-[2-chloro-6-(methylamino)purin-9-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol.
| Compound Name | 5-[2-chloro-6-(methylamino)purin-9-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 172874081 |
| Molecular Formula | C12H15ClFN5O3 |
| Molecular Weight | 331.74 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 5-[2-chloro-6-(methylamino)purin-9-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
| SMILES | CNc1nc(Cl)nc2c1ncn2C1OC(CO)C(O)C1(C)F |
| InChI | InChI=1S/C12H15ClFN5O3/c1-12(14)7(21)5(3-20)22-10(12)19-4-16-6-8(15-2)17-11(13)18-9(6)19/h4-5,7,10,20-21H,3H2,1-2H3,(H,15,17,18) |
| InChIKey | DSTPSJKWKGICEO-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.74 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |