C11H13ClFN5O3 — CID 20846061
5-(2-amino-6-chloropurin-9-yl)-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol (PubChem CID 20846061) has the molecular formula C11H13ClFN5O3 and a molecular weight of 317.71 g/mol. Its IUPAC name is 5-(2-amino-6-chloropurin-9-yl)-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol.
| Compound Name | 5-(2-amino-6-chloropurin-9-yl)-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 20846061 |
| Molecular Formula | C11H13ClFN5O3 |
| Molecular Weight | 317.71 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 5-(2-amino-6-chloropurin-9-yl)-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
| SMILES | CC1(F)C(O)C(CO)OC1n1cnc2c(Cl)nc(N)nc21 |
| InChI | InChI=1S/C11H13ClFN5O3/c1-11(13)6(20)4(2-19)21-9(11)18-3-15-5-7(12)16-10(14)17-8(5)18/h3-4,6,9,19-20H,2H2,1H3,(H2,14,16,17) |
| InChIKey | RDOBGBLNNFBMRN-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.71 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |