C11H14Cl2N6O3 — CID 156841872
(2R,3R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4,4-dichloro-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 156841872) has the molecular formula C11H14Cl2N6O3 and a molecular weight of 349.18 g/mol. Its IUPAC name is (2R,3R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4,4-dichloro-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4,4-dichloro-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 156841872 |
| Molecular Formula | C11H14Cl2N6O3 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | (2R,3R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4,4-dichloro-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | CNc1nc(N)nc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)C1(Cl)Cl |
| InChI | InChI=1S/C11H14Cl2N6O3/c1-15-7-5-8(18-10(14)17-7)19(3-16-5)9-11(12,13)6(21)4(2-20)22-9/h3-4,6,9,20-21H,2H2,1H3,(H3,14,15,17,18)/t4-,6-,9-/m1/s1 |
| InChIKey | RBDGLIRWRKONFL-NVMQTXNBSA-N |
| XLogP | -0.13 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|