C11H16ClFN6O9P2 — CID 166016048
[(2R,3R,4S,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-chloro-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 166016048) has the molecular formula C11H16ClFN6O9P2 and a molecular weight of 492.68 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-chloro-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3R,4S,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-chloro-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 166016048 |
| Molecular Formula | C11H16ClFN6O9P2 |
| Molecular Weight | 492.68 g/mol |
| Exact Mass | 492.01 |
| IUPAC Name | [(2R,3R,4S,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-chloro-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | CNc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@]1(F)Cl |
| InChI | InChI=1S/C11H16ClFN6O9P2/c1-15-7-5-8(18-10(14)17-7)19(3-16-5)9-11(12,13)6(20)4(27-9)2-26-30(24,25)28-29(21,22)23/h3-4,6,9,20H,2H2,1H3,(H,24,25)(H2,21,22,23)(H3,14,15,17,18)/t4-,6-,9-,11-/m1/s1 |
| InChIKey | KOXRDICJLMZJDB-GITKWUPZSA-N |
| XLogP | -0.16 |
| TPSA | 224.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.68 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|