C11H19N6O13P3 — CID 90307078
[[(2R,3S,5R)-5-(2,6-diaminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 90307078) has the molecular formula C11H19N6O13P3 and a molecular weight of 536.22 g/mol. Its IUPAC name is [[(2R,3S,5R)-5-(2,6-diaminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-5-(2,6-diaminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 90307078 |
| Molecular Formula | C11H19N6O13P3 |
| Molecular Weight | 536.22 g/mol |
| Exact Mass | 536.02 |
| IUPAC Name | [[(2R,3S,5R)-5-(2,6-diaminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC1(O)[C@@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1cnc2c(N)nc(N)nc21 |
| InChI | InChI=1S/C11H19N6O13P3/c1-11(19)6(18)4(2-27-32(23,24)30-33(25,26)29-31(20,21)22)28-9(11)17-3-14-5-7(12)15-10(13)16-8(5)17/h3-4,6,9,18-19H,2H2,1H3,(H,23,24)(H,25,26)(H2,20,21,22)(H4,12,13,15,16)/t4-,6+,9-,11?/m1/s1 |
| InChIKey | IYWMJCHPSGNTCK-GQGLOWJPSA-N |
| XLogP | -1.66 |
| TPSA | 305.15 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.22 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|