C16H28N7O5P — CID 91340367
2-(2,6-diaminopurin-9-yl)-5-[[ethyl-(propan-2-ylamino)phosphoryl]oxymethyl]-3-methyloxolane-3,4-diol (PubChem CID 91340367) has the molecular formula C16H28N7O5P and a molecular weight of 429.42 g/mol. Its IUPAC name is 2-(2,6-diaminopurin-9-yl)-5-[[ethyl-(propan-2-ylamino)phosphoryl]oxymethyl]-3-methyloxolane-3,4-diol.
| Compound Name | 2-(2,6-diaminopurin-9-yl)-5-[[ethyl-(propan-2-ylamino)phosphoryl]oxymethyl]-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 91340367 |
| Molecular Formula | C16H28N7O5P |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 2-(2,6-diaminopurin-9-yl)-5-[[ethyl-(propan-2-ylamino)phosphoryl]oxymethyl]-3-methyloxolane-3,4-diol |
| SMILES | CCP(=O)(NC(C)C)OCC1OC(n2cnc3c(N)nc(N)nc32)C(C)(O)C1O |
| InChI | InChI=1S/C16H28N7O5P/c1-5-29(26,22-8(2)3)27-6-9-11(24)16(4,25)14(28-9)23-7-19-10-12(17)20-15(18)21-13(10)23/h7-9,11,14,24-25H,5-6H2,1-4H3,(H,22,26)(H4,17,18,20,21) |
| InChIKey | RGFJERSBXGYBNQ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 183.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|