C25H38N7O6P — CID 90307052
(2R,4S,5R)-5-[[[[(2S)-butan-2-yl]amino]-(2-butylphenoxy)phosphoryl]oxymethyl]-2-(2,6-diaminopurin-9-yl)-3-methyloxolane-3,4-diol (PubChem CID 90307052) has the molecular formula C25H38N7O6P and a molecular weight of 563.60 g/mol. Its IUPAC name is (2R,4S,5R)-5-[[[[(2S)-butan-2-yl]amino]-(2-butylphenoxy)phosphoryl]oxymethyl]-2-(2,6-diaminopurin-9-yl)-3-methyloxolane-3,4-diol.
| Compound Name | (2R,4S,5R)-5-[[[[(2S)-butan-2-yl]amino]-(2-butylphenoxy)phosphoryl]oxymethyl]-2-(2,6-diaminopurin-9-yl)-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 90307052 |
| Molecular Formula | C25H38N7O6P |
| Molecular Weight | 563.60 g/mol |
| Exact Mass | 563.26 |
| IUPAC Name | (2R,4S,5R)-5-[[[[(2S)-butan-2-yl]amino]-(2-butylphenoxy)phosphoryl]oxymethyl]-2-(2,6-diaminopurin-9-yl)-3-methyloxolane-3,4-diol |
| SMILES | CCCCc1ccccc1O[P@@](=O)(N[C@@H](C)CC)OC[C@H]1O[C@@H](n2cnc3c(N)nc(N)nc32)C(C)(O)[C@H]1O |
| InChI | InChI=1S/C25H38N7O6P/c1-5-7-10-16-11-8-9-12-17(16)38-39(35,31-15(3)6-2)36-13-18-20(33)25(4,34)23(37-18)32-14-28-19-21(26)29-24(27)30-22(19)32/h8-9,11-12,14-15,18,20,23,33-34H,5-7,10,13H2,1-4H3,(H,31,35)(H4,26,27,29,30)/t15-,18+,20-,23+,25?,39+/m0/s1 |
| InChIKey | YPCZCZXTTYNCQG-ZTQDCBQDSA-N |
| XLogP | 2.93 |
| TPSA | 192.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.60 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|