C26H32N7O9P — CID 66780002
2-[[[(2R,3R,4R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-quinolin-8-yloxyphosphoryl]amino]-3-methylbutanoic acid (PubChem CID 66780002) has the molecular formula C26H32N7O9P and a molecular weight of 617.56 g/mol. Its IUPAC name is 2-[[[(2R,3R,4R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-quinolin-8-yloxyphosphoryl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[[(2R,3R,4R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-quinolin-8-yloxyphosphoryl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 66780002 |
| Molecular Formula | C26H32N7O9P |
| Molecular Weight | 617.56 g/mol |
| Exact Mass | 617.20 |
| IUPAC Name | 2-[[[(2R,3R,4R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-quinolin-8-yloxyphosphoryl]amino]-3-methylbutanoic acid |
| SMILES | COc1nc(N)nc2c1ncn2C1O[C@H](COP(=O)(NC(C(=O)O)C(C)C)Oc2cccc3cccnc23)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C26H32N7O9P/c1-13(2)17(23(35)36)32-43(38,42-15-9-5-7-14-8-6-10-28-18(14)15)40-11-16-20(34)26(3,37)24(41-16)33-12-29-19-21(33)30-25(27)31-22(19)39-4/h5-10,12-13,16-17,20,24,34,37H,11H2,1-4H3,(H,32,38)(H,35,36)(H2,27,30,31)/t16-,17?,20-,24?,26-,43?/m1/s1 |
| InChIKey | LBXUOHKAWUCVEK-RIDVPXQPSA-N |
| XLogP | 1.88 |
| TPSA | 226.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.56 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|