C28H36FN8O8P — CID 73292897
2,2-dimethylpropyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-quinoxalin-5-yloxyphosphoryl]amino]propanoate (PubChem CID 73292897) has the molecular formula C28H36FN8O8P and a molecular weight of 662.62 g/mol. Its IUPAC name is 2,2-dimethylpropyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-quinoxalin-5-yloxyphosphoryl]amino]propanoate.
| Compound Name | 2,2-dimethylpropyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-quinoxalin-5-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 73292897 |
| Molecular Formula | C28H36FN8O8P |
| Molecular Weight | 662.62 g/mol |
| Exact Mass | 662.24 |
| IUPAC Name | 2,2-dimethylpropyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-quinoxalin-5-yloxyphosphoryl]amino]propanoate |
| SMILES | COc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(N[C@@H](C)C(=O)OCC(C)(C)C)Oc2cccc3nccnc23)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C28H36FN8O8P/c1-15(24(39)42-13-27(2,3)4)36-46(40,45-17-9-7-8-16-19(17)32-11-10-31-16)43-12-18-21(38)28(5,29)25(44-18)37-14-33-20-22(37)34-26(30)35-23(20)41-6/h7-11,14-15,18,21,25,38H,12-13H2,1-6H3,(H,36,40)(H2,30,34,35)/t15-,18+,21+,25+,28+,46?/m0/s1 |
| InChIKey | BTIBMBHNWRJEER-WRNMFDRESA-N |
| XLogP | 3.12 |
| TPSA | 207.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.62 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|