C31H37FN7O7P — CID 139294612
2,2-dimethylpropyl (2R)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-ethynyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 139294612) has the molecular formula C31H37FN7O7P and a molecular weight of 669.65 g/mol. Its IUPAC name is 2,2-dimethylpropyl (2R)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-ethynyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | 2,2-dimethylpropyl (2R)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-ethynyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 139294612 |
| Molecular Formula | C31H37FN7O7P |
| Molecular Weight | 669.65 g/mol |
| Exact Mass | 669.25 |
| IUPAC Name | 2,2-dimethylpropyl (2R)-2-[[[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-ethynyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | C#C[C@@]1(F)[C@H](O)[C@@H](CO[P@](=O)(N[C@H](C)C(=O)OCC(C)(C)C)Oc2cccc3ccccc23)O[C@H]1n1cnc2c(NC)nc(N)nc21 |
| InChI | InChI=1S/C31H37FN7O7P/c1-7-31(32)24(40)22(45-28(31)39-17-35-23-25(34-6)36-29(33)37-26(23)39)15-44-47(42,38-18(2)27(41)43-16-30(3,4)5)46-21-14-10-12-19-11-8-9-13-20(19)21/h1,8-14,17-18,22,24,28,40H,15-16H2,2-6H3,(H,38,42)(H3,33,34,36,37)/t18-,22-,24-,28-,31-,47-/m1/s1 |
| InChIKey | CCCCPZPPMHKXNK-ZYAFXDNCSA-N |
| XLogP | 3.97 |
| TPSA | 184.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.65 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|