C31H39F2N6O7P — CID 159878437
2,2-dimethylpropyl (2R)-2-[[[(2S,3S,4R,5R)-2,4-difluoro-3-hydroxy-4-methyl-5-[2-methyl-6-(methylamino)purin-9-yl]oxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 159878437) has the molecular formula C31H39F2N6O7P and a molecular weight of 676.66 g/mol. Its IUPAC name is 2,2-dimethylpropyl (2R)-2-[[[(2S,3S,4R,5R)-2,4-difluoro-3-hydroxy-4-methyl-5-[2-methyl-6-(methylamino)purin-9-yl]oxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | 2,2-dimethylpropyl (2R)-2-[[[(2S,3S,4R,5R)-2,4-difluoro-3-hydroxy-4-methyl-5-[2-methyl-6-(methylamino)purin-9-yl]oxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 159878437 |
| Molecular Formula | C31H39F2N6O7P |
| Molecular Weight | 676.66 g/mol |
| Exact Mass | 676.26 |
| IUPAC Name | 2,2-dimethylpropyl (2R)-2-[[[(2S,3S,4R,5R)-2,4-difluoro-3-hydroxy-4-methyl-5-[2-methyl-6-(methylamino)purin-9-yl]oxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | CNc1nc(C)nc2c1ncn2[C@@H]1O[C@](F)(COP(=O)(N[C@H](C)C(=O)OCC(C)(C)C)Oc2cccc3ccccc23)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C31H39F2N6O7P/c1-18(26(40)43-15-29(3,4)5)38-47(42,46-22-14-10-12-20-11-8-9-13-21(20)22)44-16-31(33)27(41)30(6,32)28(45-31)39-17-35-23-24(34-7)36-19(2)37-25(23)39/h8-14,17-18,27-28,41H,15-16H2,1-7H3,(H,38,42)(H,34,36,37)/t18-,27+,28-,30-,31-,47?/m1/s1 |
| InChIKey | SFDRECBBZQAEHF-PHRUAYHISA-N |
| XLogP | 5.38 |
| TPSA | 158.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.66 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|