C28H34F2N7O7P — CID 138647275
propan-2-yl (2R)-2-[[[(2S,3S,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 138647275) has the molecular formula C28H34F2N7O7P and a molecular weight of 649.59 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2S,3S,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2S,3S,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 138647275 |
| Molecular Formula | C28H34F2N7O7P |
| Molecular Weight | 649.59 g/mol |
| Exact Mass | 649.22 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2S,3S,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | CNc1nc(N)nc2c1ncn2[C@@H]1O[C@](F)(COP(=O)(N[C@H](C)C(=O)OC(C)C)Oc2cccc3ccccc23)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C28H34F2N7O7P/c1-15(2)42-23(38)16(3)36-45(40,44-19-12-8-10-17-9-6-7-11-18(17)19)41-13-28(30)24(39)27(4,29)25(43-28)37-14-33-20-21(32-5)34-26(31)35-22(20)37/h6-12,14-16,24-25,39H,13H2,1-5H3,(H,36,40)(H3,31,32,34,35)/t16-,24+,25-,27-,28-,45?/m1/s1 |
| InChIKey | ZQSQVWZAGZUFAM-JXXNTYJNSA-N |
| XLogP | 4.02 |
| TPSA | 184.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.59 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|