C29H36F2N7O6PS — CID 138648038
propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-[2-amino-6-(dimethylamino)purin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphinothioyl]amino]propanoate (PubChem CID 138648038) has the molecular formula C29H36F2N7O6PS and a molecular weight of 679.69 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-[2-amino-6-(dimethylamino)purin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-[2-amino-6-(dimethylamino)purin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 138648038 |
| Molecular Formula | C29H36F2N7O6PS |
| Molecular Weight | 679.69 g/mol |
| Exact Mass | 679.22 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-[2-amino-6-(dimethylamino)purin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphinothioyl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)N[P@](=S)(OC[C@@]1(F)O[C@@H](n2cnc3c(N(C)C)nc(N)nc32)[C@](C)(F)[C@@H]1O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C29H36F2N7O6PS/c1-16(2)42-24(39)17(3)36-45(46,44-20-13-9-11-18-10-7-8-12-19(18)20)41-14-29(31)25(40)28(4,30)26(43-29)38-15-33-21-22(37(5)6)34-27(32)35-23(21)38/h7-13,15-17,25-26,40H,14H2,1-6H3,(H,36,46)(H2,32,34,35)/t17-,25-,26+,28+,29+,45-/m0/s1 |
| InChIKey | XQISGOBVZYSGNC-HKQNJWHNSA-N |
| XLogP | 4.16 |
| TPSA | 159.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.69 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|