C26H35F2N6O6PS — CID 158154982
propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-[6-(dimethylamino)-2-methylpurin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate (PubChem CID 158154982) has the molecular formula C26H35F2N6O6PS and a molecular weight of 628.64 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-[6-(dimethylamino)-2-methylpurin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-[6-(dimethylamino)-2-methylpurin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 158154982 |
| Molecular Formula | C26H35F2N6O6PS |
| Molecular Weight | 628.64 g/mol |
| Exact Mass | 628.20 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-[6-(dimethylamino)-2-methylpurin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
| SMILES | Cc1nc(N(C)C)c2ncn([C@@H]3O[C@](F)(COP(=S)(N[C@@H](C)C(=O)OC(C)C)Oc4ccccc4)[C@@H](O)[C@@]3(C)F)c2n1 |
| InChI | InChI=1S/C26H35F2N6O6PS/c1-15(2)38-22(35)16(3)32-41(42,40-18-11-9-8-10-12-18)37-13-26(28)23(36)25(5,27)24(39-26)34-14-29-19-20(33(6)7)30-17(4)31-21(19)34/h8-12,14-16,23-24,36H,13H2,1-7H3,(H,32,42)/t16-,23-,24+,25+,26+,41?/m0/s1 |
| InChIKey | ZLUIIZFBVSRIQI-SWZNPDTGSA-N |
| XLogP | 3.73 |
| TPSA | 133.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.64 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|