C26H34F2N5O8P — CID 126550056
propan-2-yl 2-[[[(2S,3S,4R,5R)-2,4-difluoro-3-hydroxy-5-[6-(methoxymethyl)-2-methylpurin-9-yl]-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 126550056) has the molecular formula C26H34F2N5O8P and a molecular weight of 613.56 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2S,3S,4R,5R)-2,4-difluoro-3-hydroxy-5-[6-(methoxymethyl)-2-methylpurin-9-yl]-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(2S,3S,4R,5R)-2,4-difluoro-3-hydroxy-5-[6-(methoxymethyl)-2-methylpurin-9-yl]-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 126550056 |
| Molecular Formula | C26H34F2N5O8P |
| Molecular Weight | 613.56 g/mol |
| Exact Mass | 613.21 |
| IUPAC Name | propan-2-yl 2-[[[(2S,3S,4R,5R)-2,4-difluoro-3-hydroxy-5-[6-(methoxymethyl)-2-methylpurin-9-yl]-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | COCc1nc(C)nc2c1ncn2[C@@H]1O[C@](F)(CO[P@@](=O)(NC(C)C(=O)OC(C)C)Oc2ccccc2)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C26H34F2N5O8P/c1-15(2)39-22(34)16(3)32-42(36,41-18-10-8-7-9-11-18)38-13-26(28)23(35)25(5,27)24(40-26)33-14-29-20-19(12-37-6)30-17(4)31-21(20)33/h7-11,14-16,23-24,35H,12-13H2,1-6H3,(H,32,36)/t16?,23-,24+,25+,26+,42-/m0/s1 |
| InChIKey | MNSJKIJAFVAEEH-DHPFTOGNSA-N |
| XLogP | 3.70 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|