C28H37F2N6O8P — CID 129152330
cyclohexyl (2S)-2-[[[(2S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 129152330) has the molecular formula C28H37F2N6O8P and a molecular weight of 654.61 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[[(2S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl (2S)-2-[[[(2S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 129152330 |
| Molecular Formula | C28H37F2N6O8P |
| Molecular Weight | 654.61 g/mol |
| Exact Mass | 654.24 |
| IUPAC Name | cyclohexyl (2S)-2-[[[(2S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@](F)(CO[P@](=O)(N[C@@H](C)C(=O)OC2CCCCC2)Oc2ccccc2)C(O)[C@@]1(C)F |
| InChI | InChI=1S/C28H37F2N6O8P/c1-4-40-22-20-21(33-26(31)34-22)36(16-32-20)25-27(3,29)24(38)28(30,43-25)15-41-45(39,44-19-13-9-6-10-14-19)35-17(2)23(37)42-18-11-7-5-8-12-18/h6,9-10,13-14,16-18,24-25,38H,4-5,7-8,11-12,15H2,1-3H3,(H,35,39)(H2,31,33,34)/t17-,24?,25+,27+,28+,45+/m0/s1 |
| InChIKey | AXPZRRYJJBWEBT-OTFHKPQGSA-N |
| XLogP | 4.15 |
| TPSA | 182.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.61 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|