C27H37F2N6O8P — CID 90251595
2,2-dimethylpropyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 90251595) has the molecular formula C27H37F2N6O8P and a molecular weight of 642.60 g/mol. Its IUPAC name is 2,2-dimethylpropyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2,2-dimethylpropyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90251595 |
| Molecular Formula | C27H37F2N6O8P |
| Molecular Weight | 642.60 g/mol |
| Exact Mass | 642.24 |
| IUPAC Name | 2,2-dimethylpropyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@](F)(COP(=O)(N[C@@H](C)C(=O)OCC(C)(C)C)Oc2ccccc2)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C27H37F2N6O8P/c1-7-39-20-18-19(32-24(30)33-20)35(15-31-18)23-26(6,28)22(37)27(29,42-23)14-41-44(38,43-17-11-9-8-10-12-17)34-16(2)21(36)40-13-25(3,4)5/h8-12,15-16,22-23,37H,7,13-14H2,1-6H3,(H,34,38)(H2,30,32,33)/t16-,22-,23+,26+,27+,44?/m0/s1 |
| InChIKey | FQDBUQHZAJTAPB-MVEGOUAISA-N |
| XLogP | 3.86 |
| TPSA | 182.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.60 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|