C28H38F2N5O8P — CID 90251419
pentan-3-yl 2-[[[(2S,3S,4R,5R)-5-(6-ethoxy-2-methylpurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 90251419) has the molecular formula C28H38F2N5O8P and a molecular weight of 641.61 g/mol. Its IUPAC name is pentan-3-yl 2-[[[(2S,3S,4R,5R)-5-(6-ethoxy-2-methylpurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | pentan-3-yl 2-[[[(2S,3S,4R,5R)-5-(6-ethoxy-2-methylpurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90251419 |
| Molecular Formula | C28H38F2N5O8P |
| Molecular Weight | 641.61 g/mol |
| Exact Mass | 641.24 |
| IUPAC Name | pentan-3-yl 2-[[[(2S,3S,4R,5R)-5-(6-ethoxy-2-methylpurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOc1nc(C)nc2c1ncn2[C@@H]1O[C@](F)(COP(=O)(NC(C)C(=O)OC(CC)CC)Oc2ccccc2)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C28H38F2N5O8P/c1-7-19(8-2)41-24(36)17(4)34-44(38,43-20-13-11-10-12-14-20)40-15-28(30)25(37)27(6,29)26(42-28)35-16-31-21-22(35)32-18(5)33-23(21)39-9-3/h10-14,16-17,19,25-26,37H,7-9,15H2,1-6H3,(H,34,38)/t17?,25-,26+,27+,28+,44?/m0/s1 |
| InChIKey | YTXHCPWBTLCUTF-ONIHUQKLSA-N |
| XLogP | 4.73 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.61 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|