C30H36F2N5O8P — CID 90251446
cyclohexyl 2-[[[(2S,3S,4R,5R)-5-(6-ethoxy-2-methylpurin-9-yl)-4-ethynyl-2,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 90251446) has the molecular formula C30H36F2N5O8P and a molecular weight of 663.62 g/mol. Its IUPAC name is cyclohexyl 2-[[[(2S,3S,4R,5R)-5-(6-ethoxy-2-methylpurin-9-yl)-4-ethynyl-2,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl 2-[[[(2S,3S,4R,5R)-5-(6-ethoxy-2-methylpurin-9-yl)-4-ethynyl-2,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90251446 |
| Molecular Formula | C30H36F2N5O8P |
| Molecular Weight | 663.62 g/mol |
| Exact Mass | 663.23 |
| IUPAC Name | cyclohexyl 2-[[[(2S,3S,4R,5R)-5-(6-ethoxy-2-methylpurin-9-yl)-4-ethynyl-2,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#C[C@]1(F)[C@H](n2cnc3c(OCC)nc(C)nc32)O[C@](F)(COP(=O)(NC(C)C(=O)OC2CCCCC2)Oc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C30H36F2N5O8P/c1-5-29(31)27(39)30(32,44-28(29)37-18-33-23-24(37)34-20(4)35-25(23)41-6-2)17-42-46(40,45-22-15-11-8-12-16-22)36-19(3)26(38)43-21-13-9-7-10-14-21/h1,8,11-12,15-16,18-19,21,27-28,39H,6-7,9-10,13-14,17H2,2-4H3,(H,36,40)/t19?,27-,28+,29+,30+,46?/m0/s1 |
| InChIKey | VWLXECWHMAVJCF-AYQVBBPLSA-N |
| XLogP | 4.49 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|