C29H39F2N6O8P — CID 137454095
cyclohexyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]methylamino]propanoate (PubChem CID 137454095) has the molecular formula C29H39F2N6O8P and a molecular weight of 668.64 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]methylamino]propanoate.
| Compound Name | cyclohexyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]methylamino]propanoate |
|---|---|
| PubChem CID | 137454095 |
| Molecular Formula | C29H39F2N6O8P |
| Molecular Weight | 668.64 g/mol |
| Exact Mass | 668.25 |
| IUPAC Name | cyclohexyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]methylamino]propanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@](F)(COP(=O)(CN[C@@H](C)C(=O)OC2CCCCC2)Oc2ccccc2)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C29H39F2N6O8P/c1-4-41-23-21-22(35-27(32)36-23)37(16-33-21)26-28(3,30)25(39)29(31,44-26)15-42-46(40,45-20-13-9-6-10-14-20)17-34-18(2)24(38)43-19-11-7-5-8-12-19/h6,9-10,13-14,16,18-19,25-26,34,39H,4-5,7-8,11-12,15,17H2,1-3H3,(H2,32,35,36)/t18-,25-,26+,28+,29+,46?/m0/s1 |
| InChIKey | OKOQFVASZITEDA-HVQBEFEJSA-N |
| XLogP | 4.19 |
| TPSA | 182.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.64 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|