C29H34FN6O9P — CID 134255705
cyclohexyl 2-[[[(1S,3R,4R,5S,6S)-3-(2-amino-6-ethoxypurin-9-yl)-4-ethynyl-1-fluoro-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 134255705) has the molecular formula C29H34FN6O9P and a molecular weight of 660.60 g/mol. Its IUPAC name is cyclohexyl 2-[[[(1S,3R,4R,5S,6S)-3-(2-amino-6-ethoxypurin-9-yl)-4-ethynyl-1-fluoro-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl 2-[[[(1S,3R,4R,5S,6S)-3-(2-amino-6-ethoxypurin-9-yl)-4-ethynyl-1-fluoro-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 134255705 |
| Molecular Formula | C29H34FN6O9P |
| Molecular Weight | 660.60 g/mol |
| Exact Mass | 660.21 |
| IUPAC Name | cyclohexyl 2-[[[(1S,3R,4R,5S,6S)-3-(2-amino-6-ethoxypurin-9-yl)-4-ethynyl-1-fluoro-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#C[C@]1(O)[C@H](n2cnc3c(OCC)nc(N)nc32)O[C@]2(F)[C@@H](O[P@](=O)(NC(C)C(=O)OC3CCCCC3)Oc3ccccc3)[C@]12O |
| InChI | InChI=1S/C29H34FN6O9P/c1-4-27(38)25(36-16-32-20-21(36)33-26(31)34-22(20)41-5-2)43-29(30)24(28(27,29)39)45-46(40,44-19-14-10-7-11-15-19)35-17(3)23(37)42-18-12-8-6-9-13-18/h1,7,10-11,14-18,24-25,38-39H,5-6,8-9,12-13H2,2-3H3,(H,35,40)(H2,31,33,34)/t17?,24-,25+,27-,28-,29+,46-/m0/s1 |
| InChIKey | BGUVUAWPVRFVLJ-QBNSVKQUSA-N |
| XLogP | 2.54 |
| TPSA | 202.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.60 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|