C27H32FN6O7P — CID 166026851
cyclohexyl (2S)-2-[[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-yl]oxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166026851) has the molecular formula C27H32FN6O7P and a molecular weight of 602.56 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-yl]oxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl (2S)-2-[[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-yl]oxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166026851 |
| Molecular Formula | C27H32FN6O7P |
| Molecular Weight | 602.56 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | cyclohexyl (2S)-2-[[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-yl]oxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#C[C@]1(CO)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1O[P@@](=O)(N[C@@H](C)C(=O)OC1CCCCC1)Oc1ccccc1 |
| InChI | InChI=1S/C27H32FN6O7P/c1-3-27(15-35)20(14-21(39-27)34-16-30-22-23(29)31-26(28)32-24(22)34)41-42(37,40-19-12-8-5-9-13-19)33-17(2)25(36)38-18-10-6-4-7-11-18/h1,5,8-9,12-13,16-18,20-21,35H,4,6-7,10-11,14-15H2,2H3,(H,33,37)(H2,29,31,32)/t17-,20-,21+,27+,42+/m0/s1 |
| InChIKey | UBMGEFHJKDTWOX-FMFYELQHSA-N |
| XLogP | 3.26 |
| TPSA | 172.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.56 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|