C37H52FN6O9P — CID 170943192
2-ethylbutyl (2S)-2-[[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-nonoxycarbonyloxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 170943192) has the molecular formula C37H52FN6O9P and a molecular weight of 774.83 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-nonoxycarbonyloxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-nonoxycarbonyloxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 170943192 |
| Molecular Formula | C37H52FN6O9P |
| Molecular Weight | 774.83 g/mol |
| Exact Mass | 774.35 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-nonoxycarbonyloxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#C[C@]1(CO[P@@](=O)(N[C@@H](C)C(=O)OCC(CC)CC)Oc2ccccc2)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1OC(=O)OCCCCCCCCC |
| InChI | InChI=1S/C37H52FN6O9P/c1-6-10-11-12-13-14-18-21-48-36(46)51-29-22-30(44-25-40-31-32(39)41-35(38)42-33(31)44)52-37(29,9-4)24-50-54(47,53-28-19-16-15-17-20-28)43-26(5)34(45)49-23-27(7-2)8-3/h4,15-17,19-20,25-27,29-30H,6-8,10-14,18,21-24H2,1-3,5H3,(H,43,47)(H2,39,41,42)/t26-,29-,30+,37+,54-/m0/s1 |
| InChIKey | HWVANBRCHXSEEO-BRWFROHESA-N |
| XLogP | 7.27 |
| TPSA | 188.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.83 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|