C43H56FN6O8P — CID 174209454
[5-(6-amino-2-fluoropurin-9-yl)-2-[[[[1-(2-ethylbutoxy)-1-oxo-3-phenylpropan-2-yl]amino]-phenoxyphosphoryl]oxymethyl]-2-ethynyloxolan-3-yl] decanoate (PubChem CID 174209454) has the molecular formula C43H56FN6O8P and a molecular weight of 834.93 g/mol. Its IUPAC name is [5-(6-amino-2-fluoropurin-9-yl)-2-[[[[1-(2-ethylbutoxy)-1-oxo-3-phenylpropan-2-yl]amino]-phenoxyphosphoryl]oxymethyl]-2-ethynyloxolan-3-yl] decanoate.
| Compound Name | [5-(6-amino-2-fluoropurin-9-yl)-2-[[[[1-(2-ethylbutoxy)-1-oxo-3-phenylpropan-2-yl]amino]-phenoxyphosphoryl]oxymethyl]-2-ethynyloxolan-3-yl] decanoate |
|---|---|
| PubChem CID | 174209454 |
| Molecular Formula | C43H56FN6O8P |
| Molecular Weight | 834.93 g/mol |
| Exact Mass | 834.39 |
| IUPAC Name | [5-(6-amino-2-fluoropurin-9-yl)-2-[[[[1-(2-ethylbutoxy)-1-oxo-3-phenylpropan-2-yl]amino]-phenoxyphosphoryl]oxymethyl]-2-ethynyloxolan-3-yl] decanoate |
| SMILES | C#CC1(CO[P@@](=O)(NC(Cc2ccccc2)C(=O)OCC(CC)CC)Oc2ccccc2)OC(n2cnc3c(N)nc(F)nc32)CC1OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C43H56FN6O8P/c1-5-9-10-11-12-13-20-25-37(51)56-35-27-36(50-30-46-38-39(45)47-42(44)48-40(38)50)57-43(35,8-4)29-55-59(53,58-33-23-18-15-19-24-33)49-34(26-32-21-16-14-17-22-32)41(52)54-28-31(6-2)7-3/h4,14-19,21-24,30-31,34-36H,5-7,9-13,20,25-29H2,1-3H3,(H,49,53)(H2,45,47,48)/t34?,35?,36?,43?,59-/m0/s1 |
| InChIKey | MLHQWRQGTMJITQ-ARYRTBSDSA-N |
| XLogP | 8.27 |
| TPSA | 179.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.93 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|