C35H48FN6O9P — CID 170943206
2-ethylbutyl (2S)-2-[[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-heptan-4-yloxycarbonyloxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 170943206) has the molecular formula C35H48FN6O9P and a molecular weight of 746.77 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-heptan-4-yloxycarbonyloxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-heptan-4-yloxycarbonyloxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 170943206 |
| Molecular Formula | C35H48FN6O9P |
| Molecular Weight | 746.77 g/mol |
| Exact Mass | 746.32 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-heptan-4-yloxycarbonyloxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#C[C@]1(CO[P@@](=O)(N[C@@H](C)C(=O)OCC(CC)CC)Oc2ccccc2)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1OC(=O)OC(CCC)CCC |
| InChI | InChI=1S/C35H48FN6O9P/c1-7-15-25(16-8-2)48-34(44)49-27-19-28(42-22-38-29-30(37)39-33(36)40-31(29)42)50-35(27,11-5)21-47-52(45,51-26-17-13-12-14-18-26)41-23(6)32(43)46-20-24(9-3)10-4/h5,12-14,17-18,22-25,27-28H,7-10,15-16,19-21H2,1-4,6H3,(H,41,45)(H2,37,39,40)/t23-,27-,28+,35+,52-/m0/s1 |
| InChIKey | COQXMQYFMXOWDD-DABMTRNGSA-N |
| XLogP | 6.49 |
| TPSA | 188.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.77 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|