C31H42FN6O7P — CID 168741442
decyl (2S)-2-[[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 168741442) has the molecular formula C31H42FN6O7P and a molecular weight of 660.68 g/mol. Its IUPAC name is decyl (2S)-2-[[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | decyl (2S)-2-[[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 168741442 |
| Molecular Formula | C31H42FN6O7P |
| Molecular Weight | 660.68 g/mol |
| Exact Mass | 660.28 |
| IUPAC Name | decyl (2S)-2-[[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#C[C@]1(CO[P@](=O)(N[C@@H](C)C(=O)OCCCCCCCCCC)Oc2ccccc2)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1O |
| InChI | InChI=1S/C31H42FN6O7P/c1-4-6-7-8-9-10-11-15-18-42-29(40)22(3)37-46(41,45-23-16-13-12-14-17-23)43-20-31(5-2)24(39)19-25(44-31)38-21-34-26-27(33)35-30(32)36-28(26)38/h2,12-14,16-17,21-22,24-25,39H,4,6-11,15,18-20H2,1,3H3,(H,37,41)(H2,33,35,36)/t22-,24-,25+,31+,46+/m0/s1 |
| InChIKey | GEZLIYXLUKOSJW-HONDPOFRSA-N |
| XLogP | 5.07 |
| TPSA | 172.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.68 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|