C28H28ClN6O7P — CID 166551481
benzyl (2S)-2-[[[(2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166551481) has the molecular formula C28H28ClN6O7P and a molecular weight of 626.99 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[[(2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166551481 |
| Molecular Formula | C28H28ClN6O7P |
| Molecular Weight | 626.99 g/mol |
| Exact Mass | 626.14 |
| IUPAC Name | benzyl (2S)-2-[[[(2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#C[C@]1(COP(=O)(N[C@@H](C)C(=O)OCc2ccccc2)Oc2ccccc2)O[C@@H](n2cnc3c(N)nc(Cl)nc32)C[C@@H]1O |
| InChI | InChI=1S/C28H28ClN6O7P/c1-3-28(21(36)14-22(41-28)35-17-31-23-24(30)32-27(29)33-25(23)35)16-40-43(38,42-20-12-8-5-9-13-20)34-18(2)26(37)39-15-19-10-6-4-7-11-19/h1,4-13,17-18,21-22,36H,14-16H2,2H3,(H,34,38)(H2,30,32,33)/t18-,21-,22+,28+,43?/m0/s1 |
| InChIKey | UEUHYKWLNUQNQH-YZMDBSKNSA-N |
| XLogP | 3.64 |
| TPSA | 172.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.99 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|