C23H32ClN6O10P — CID 166551558
propan-2-yl (2R)-2-[[[(2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]amino]propanoate (PubChem CID 166551558) has the molecular formula C23H32ClN6O10P and a molecular weight of 618.97 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166551558 |
| Molecular Formula | C23H32ClN6O10P |
| Molecular Weight | 618.97 g/mol |
| Exact Mass | 618.16 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]amino]propanoate |
| SMILES | C#C[C@]1(CO[P@@](=O)(N[C@H](C)C(=O)OC(C)C)OCOC(=O)OC(C)C)O[C@@H](n2cnc3c(N)nc(Cl)nc32)C[C@@H]1O |
| InChI | InChI=1S/C23H32ClN6O10P/c1-7-23(15(31)8-16(40-23)30-10-26-17-18(25)27-21(24)28-19(17)30)9-36-41(34,29-14(6)20(32)38-12(2)3)37-11-35-22(33)39-13(4)5/h1,10,12-16,31H,8-9,11H2,2-6H3,(H,29,34)(H2,25,27,28)/t14-,15+,16-,23-,41+/m1/s1 |
| InChIKey | GAFOINWPTWWEFF-KPNLSDFRSA-N |
| XLogP | 2.30 |
| TPSA | 208.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.97 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|