C20H26FN5O4 — CID 139480609
[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl 2-propylpentanoate (PubChem CID 139480609) has the molecular formula C20H26FN5O4 and a molecular weight of 419.46 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl 2-propylpentanoate.
| Compound Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl 2-propylpentanoate |
|---|---|
| PubChem CID | 139480609 |
| Molecular Formula | C20H26FN5O4 |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl 2-propylpentanoate |
| SMILES | C#C[C@]1(COC(=O)C(CCC)CCC)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1O |
| InChI | InChI=1S/C20H26FN5O4/c1-4-7-12(8-5-2)18(28)29-10-20(6-3)13(27)9-14(30-20)26-11-23-15-16(22)24-19(21)25-17(15)26/h3,11-14,27H,4-5,7-10H2,1-2H3,(H2,22,24,25)/t13-,14+,20+/m0/s1 |
| InChIKey | IWRIQHXEEKDPFJ-LRDNONRASA-N |
| XLogP | 1.96 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|