C23H30FN5O5 — CID 167223673
[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl 3,3-diethylhex-5-enyl carbonate (PubChem CID 167223673) has the molecular formula C23H30FN5O5 and a molecular weight of 475.52 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl 3,3-diethylhex-5-enyl carbonate.
| Compound Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl 3,3-diethylhex-5-enyl carbonate |
|---|---|
| PubChem CID | 167223673 |
| Molecular Formula | C23H30FN5O5 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl 3,3-diethylhex-5-enyl carbonate |
| SMILES | C#C[C@]1(COC(=O)OCCC(CC)(CC)CC=C)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1O |
| InChI | InChI=1S/C23H30FN5O5/c1-5-9-22(6-2,7-3)10-11-32-21(31)33-13-23(8-4)15(30)12-16(34-23)29-14-26-17-18(25)27-20(24)28-19(17)29/h4-5,14-16,30H,1,6-7,9-13H2,2-3H3,(H2,25,27,28)/t15-,16+,23+/m0/s1 |
| InChIKey | YRJXTZXPJIXCJP-NXHTTZLHSA-N |
| XLogP | 3.13 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|