C18H26FN5O3Si — CID 175847381
5-(6-amino-2-fluoropurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethynyloxolan-3-ol (PubChem CID 175847381) has the molecular formula C18H26FN5O3Si and a molecular weight of 407.52 g/mol. Its IUPAC name is 5-(6-amino-2-fluoropurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethynyloxolan-3-ol.
| Compound Name | 5-(6-amino-2-fluoropurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethynyloxolan-3-ol |
|---|---|
| PubChem CID | 175847381 |
| Molecular Formula | C18H26FN5O3Si |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 5-(6-amino-2-fluoropurin-9-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethynyloxolan-3-ol |
| SMILES | C#CC1(CO[Si](C)(C)C(C)(C)C)OC(n2cnc3c(N)nc(F)nc32)CC1O |
| InChI | InChI=1S/C18H26FN5O3Si/c1-7-18(9-26-28(5,6)17(2,3)4)11(25)8-12(27-18)24-10-21-13-14(20)22-16(19)23-15(13)24/h1,10-12,25H,8-9H2,2-6H3,(H2,20,22,23) |
| InChIKey | PIVBUXNRWQCQKL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|