C14H15FN6O4 — CID 155685089
[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl 2-aminoacetate (PubChem CID 155685089) has the molecular formula C14H15FN6O4 and a molecular weight of 350.31 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl 2-aminoacetate.
| Compound Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl 2-aminoacetate |
|---|---|
| PubChem CID | 155685089 |
| Molecular Formula | C14H15FN6O4 |
| Molecular Weight | 350.31 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl 2-aminoacetate |
| SMILES | C#C[C@]1(COC(=O)CN)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1O |
| InChI | InChI=1S/C14H15FN6O4/c1-2-14(5-24-9(23)4-16)7(22)3-8(25-14)21-6-18-10-11(17)19-13(15)20-12(10)21/h1,6-8,22H,3-5,16H2,(H2,17,19,20)/t7-,8+,14+/m0/s1 |
| InChIKey | DTRRLWNAZAEWKJ-PSQXESDUSA-N |
| XLogP | -1.30 |
| TPSA | 151.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.31 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|