C32H48FN5O5 — CID 155685157
[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3-decanoyloxy-2-ethynyloxolan-2-yl]methyl decanoate (PubChem CID 155685157) has the molecular formula C32H48FN5O5 and a molecular weight of 601.76 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3-decanoyloxy-2-ethynyloxolan-2-yl]methyl decanoate.
| Compound Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3-decanoyloxy-2-ethynyloxolan-2-yl]methyl decanoate |
|---|---|
| PubChem CID | 155685157 |
| Molecular Formula | C32H48FN5O5 |
| Molecular Weight | 601.76 g/mol |
| Exact Mass | 601.36 |
| IUPAC Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3-decanoyloxy-2-ethynyloxolan-2-yl]methyl decanoate |
| SMILES | C#C[C@]1(COC(=O)CCCCCCCCC)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C32H48FN5O5/c1-4-7-9-11-13-15-17-19-26(39)41-22-32(6-3)24(42-27(40)20-18-16-14-12-10-8-5-2)21-25(43-32)38-23-35-28-29(34)36-31(33)37-30(28)38/h3,23-25H,4-5,7-22H2,1-2H3,(H2,34,36,37)/t24-,25+,32+/m0/s1 |
| InChIKey | ARUGEEJBBFQOAD-BRUQSJHLSA-N |
| XLogP | 6.57 |
| TPSA | 131.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.76 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|