C20H26FN5O3 — CID 162390748
[5-(6-amino-2-fluoropurin-9-yl)-2-ethynyloxolan-2-yl]methyl octanoate (PubChem CID 162390748) has the molecular formula C20H26FN5O3 and a molecular weight of 403.46 g/mol. Its IUPAC name is [5-(6-amino-2-fluoropurin-9-yl)-2-ethynyloxolan-2-yl]methyl octanoate.
| Compound Name | [5-(6-amino-2-fluoropurin-9-yl)-2-ethynyloxolan-2-yl]methyl octanoate |
|---|---|
| PubChem CID | 162390748 |
| Molecular Formula | C20H26FN5O3 |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | [5-(6-amino-2-fluoropurin-9-yl)-2-ethynyloxolan-2-yl]methyl octanoate |
| SMILES | C#CC1(COC(=O)CCCCCCC)CCC(n2cnc3c(N)nc(F)nc32)O1 |
| InChI | InChI=1S/C20H26FN5O3/c1-3-5-6-7-8-9-15(27)28-12-20(4-2)11-10-14(29-20)26-13-23-16-17(22)24-19(21)25-18(16)26/h2,13-14H,3,5-12H2,1H3,(H2,22,24,25) |
| InChIKey | BSGIBIPLHZBHBG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|