C25H34FN5O4 — CID 167276139
[(2R,5R)-2-ethynyl-5-[2-fluoro-6-(octanoylamino)purin-9-yl]oxolan-2-yl]methyl pentanoate (PubChem CID 167276139) has the molecular formula C25H34FN5O4 and a molecular weight of 487.58 g/mol. Its IUPAC name is [(2R,5R)-2-ethynyl-5-[2-fluoro-6-(octanoylamino)purin-9-yl]oxolan-2-yl]methyl pentanoate.
| Compound Name | [(2R,5R)-2-ethynyl-5-[2-fluoro-6-(octanoylamino)purin-9-yl]oxolan-2-yl]methyl pentanoate |
|---|---|
| PubChem CID | 167276139 |
| Molecular Formula | C25H34FN5O4 |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | [(2R,5R)-2-ethynyl-5-[2-fluoro-6-(octanoylamino)purin-9-yl]oxolan-2-yl]methyl pentanoate |
| SMILES | C#C[C@@]1(COC(=O)CCCC)CC[C@H](n2cnc3c(NC(=O)CCCCCCC)nc(F)nc32)O1 |
| InChI | InChI=1S/C25H34FN5O4/c1-4-7-9-10-11-12-18(32)28-22-21-23(30-24(26)29-22)31(17-27-21)19-14-15-25(6-3,35-19)16-34-20(33)13-8-5-2/h3,17,19H,4-5,7-16H2,1-2H3,(H,28,29,30,32)/t19-,25+/m1/s1 |
| InChIKey | XOXBWPISONBLKG-CLOONOSVSA-N |
| XLogP | 4.68 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|