C12H12FN5O2 — CID 164595382
[(2R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyloxolan-2-yl]methanol (PubChem CID 164595382) has the molecular formula C12H12FN5O2 and a molecular weight of 277.26 g/mol. Its IUPAC name is [(2R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyloxolan-2-yl]methanol.
| Compound Name | [(2R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 164595382 |
| Molecular Formula | C12H12FN5O2 |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | [(2R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyloxolan-2-yl]methanol |
| SMILES | C#C[C@@]1(CO)CCC(n2cnc3c(N)nc(F)nc32)O1 |
| InChI | InChI=1S/C12H12FN5O2/c1-2-12(5-19)4-3-7(20-12)18-6-15-8-9(14)16-11(13)17-10(8)18/h1,6-7,19H,3-5H2,(H2,14,16,17)/t7?,12-/m0/s1 |
| InChIKey | KLXASYNEJRYFMO-LRUBCLLZSA-N |
| XLogP | 0.22 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|