C12H10FN5O2 — CID 6483435
[(2R,5R)-2-(6-amino-2-fluoropurin-9-yl)-5-ethynyl-2H-furan-5-yl]methanol (PubChem CID 6483435) has the molecular formula C12H10FN5O2 and a molecular weight of 275.24 g/mol. Its IUPAC name is [(2R,5R)-2-(6-amino-2-fluoropurin-9-yl)-5-ethynyl-2H-furan-5-yl]methanol.
| Compound Name | [(2R,5R)-2-(6-amino-2-fluoropurin-9-yl)-5-ethynyl-2H-furan-5-yl]methanol |
|---|---|
| PubChem CID | 6483435 |
| Molecular Formula | C12H10FN5O2 |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | [(2R,5R)-2-(6-amino-2-fluoropurin-9-yl)-5-ethynyl-2H-furan-5-yl]methanol |
| SMILES | C#C[C@@]1(CO)C=C[C@H](n2cnc3c(N)nc(F)nc32)O1 |
| InChI | InChI=1S/C12H10FN5O2/c1-2-12(5-19)4-3-7(20-12)18-6-15-8-9(14)16-11(13)17-10(8)18/h1,3-4,6-7,19H,5H2,(H2,14,16,17)/t7-,12+/m1/s1 |
| InChIKey | AHGUGKZOPNWSMI-KRTXAFLBSA-N |
| XLogP | -0.00 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|