C13H16FN5O3 — CID 176809457
(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-(hydroxymethyl)-2-[(E)-prop-1-enyl]oxolan-3-ol (PubChem CID 176809457) has the molecular formula C13H16FN5O3 and a molecular weight of 309.30 g/mol. Its IUPAC name is (2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-(hydroxymethyl)-2-[(E)-prop-1-enyl]oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-(hydroxymethyl)-2-[(E)-prop-1-enyl]oxolan-3-ol |
|---|---|
| PubChem CID | 176809457 |
| Molecular Formula | C13H16FN5O3 |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-(hydroxymethyl)-2-[(E)-prop-1-enyl]oxolan-3-ol |
| SMILES | C/C=C/[C@]1(CO)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1O |
| InChI | InChI=1S/C13H16FN5O3/c1-2-3-13(5-20)7(21)4-8(22-13)19-6-16-9-10(15)17-12(14)18-11(9)19/h2-3,6-8,20-21H,4-5H2,1H3,(H2,15,17,18)/b3-2+/t7-,8+,13+/m0/s1 |
| InChIKey | INBLYBSGYTWMLH-SEPHQMMOSA-N |
| XLogP | 0.13 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|